CAS 860610-84-0 is the registry number for 7-(4-Chlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-(4-chlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (CAS 860610-84-0) is a chemical compound with the molecular formula C14H9ClN4 and a molecular weight of 268.70 g/mol. IUPAC name: 7-(4-chlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile. InChIKey: XALFMKUQQDGJCI-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN4 |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 7-(4-chlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| InChIKey | XALFMKUQQDGJCI-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=CC(=C(C2=N1)C#N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)