Products 860651-05-4
CAS 860651-05-4 is the registry number for 2-[4-(4-Fluorophenyl)-3-methyl-5-oxo-4,5-dihydro-1h-1,2,4-triazol-1-yl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(4-fluorophenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]acetonitrile (CAS 860651-05-4) is a chemical compound with the molecular formula C11H9FN4O and a molecular weight of 232.21 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]acetonitrile. InChIKey: LWNYVUFSHJVIGB-UHFFFAOYSA-N.
| Molecular formula | C11H9FN4O |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 2-[4-(4-fluorophenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]acetonitrile |
| InChIKey | LWNYVUFSHJVIGB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)N1C2=CC=C(C=C2)F)CC#N |
Computed by PubChem (NCBI)