CAS 860677-85-6 is the registry number for 2-(4-Iodo-phenoxy)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-iodophenoxy)aniline (CAS 860677-85-6) is a chemical compound with the molecular formula C12H10INO and a molecular weight of 311.12 g/mol. IUPAC name: 2-(4-iodophenoxy)aniline. InChIKey: DGWORJAETOAVQW-UHFFFAOYSA-N.
| Molecular formula | C12H10INO |
|---|---|
| Molecular weight | 311.12 g/mol |
| IUPAC name | 2-(4-iodophenoxy)aniline |
| InChIKey | DGWORJAETOAVQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)