CAS 860784-08-3 is the registry number for 2-(6,8-Dibromoquinolin-2-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(6,8-dibromoquinolin-2-yl)phenol (CAS 860784-08-3) is a chemical compound with the molecular formula C15H9Br2NO and a molecular weight of 379.05 g/mol. IUPAC name: 2-(6,8-dibromoquinolin-2-yl)phenol. InChIKey: QRGPKNOZEUPVIL-UHFFFAOYSA-N.
| Molecular formula | C15H9Br2NO |
|---|---|
| Molecular weight | 379.05 g/mol |
| IUPAC name | 2-(6,8-dibromoquinolin-2-yl)phenol |
| InChIKey | QRGPKNOZEUPVIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(C=C(C=C3C=C2)Br)Br)O |
Computed by PubChem (NCBI)