CAS 860804-18-8 is the registry number for Bencycloquidium bromide. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
1-cyclopentyl-2-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1-phenylethanol bromide (CAS 860804-18-8) is a chemical compound with the molecular formula C21H32BrNO2 and a molecular weight of 410.4 g/mol. IUPAC name: 1-cyclopentyl-2-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1-phenylethanol bromide. InChIKey: LMUJEWVKOCYOQL-UHFFFAOYSA-M.
| Molecular formula | C21H32BrNO2 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 1-cyclopentyl-2-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1-phenylethanol bromide |
| InChIKey | LMUJEWVKOCYOQL-UHFFFAOYSA-M |
| SMILES | C[N+]12CCC(CC1)C(C2)OCC(C3CCCC3)(C4=CC=CC=C4)O.[Br-] |
Computed by PubChem (NCBI)