CAS 860815-11-8 appears in our catalog under these names: 2-(3-Fluorophenyl)ethanimidamide hydrochloride, 98%, 2-(3-Fluorophenyl)ethanimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
2-(3-fluorophenyl)ethanimidamide;hydrochloride (CAS 860815-11-8) is a chemical compound with the molecular formula C8H10ClFN2 and a molecular weight of 188.63 g/mol. IUPAC name: 2-(3-fluorophenyl)ethanimidamide;hydrochloride. InChIKey: BBFVSHCCQYWKSH-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2 |
|---|---|
| Molecular weight | 188.63 g/mol |
| IUPAC name | 2-(3-fluorophenyl)ethanimidamide;hydrochloride |
| InChIKey | BBFVSHCCQYWKSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=N)N.Cl |
Computed by PubChem (NCBI)