Products 861088-36-0

CAS 861088-36-0 is the registry number for 6-Hydroxy-decahydronaphthalene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid (CAS 861088-36-0) is a chemical compound with the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. IUPAC name: 6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid. InChIKey: KOXKKMGRIJEISW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O3
Molecular weight198.26 g/mol
IUPAC name6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid
InChIKeyKOXKKMGRIJEISW-UHFFFAOYSA-N
SMILESC1CC2CC(CCC2C(C1)C(=O)O)O

Computed by PubChem (NCBI)