CAS 861100-75-6 is the registry number for Benzo[d]thiazole-2,4-diamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-benzothiazole-2,4-diamine (CAS 861100-75-6) is a chemical compound with the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. IUPAC name: 1,3-benzothiazole-2,4-diamine. InChIKey: JHRMJWGBGBDNJE-UHFFFAOYSA-N.
| Molecular formula | C7H7N3S |
|---|---|
| Molecular weight | 165.22 g/mol |
| IUPAC name | 1,3-benzothiazole-2,4-diamine |
| InChIKey | JHRMJWGBGBDNJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)N |
Computed by PubChem (NCBI)