CAS 861214-33-7 appears in our catalog under these names: 5'–Fluoroindirubinoxime, 5'-Fluoroindirubinoxime/ 100%, 5'-Fluoroindirubinoxime 98%, 5'-Fluoroindirubinoxime, 98%, 98%, 5'-Fluoroindirubinoxime, 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g.
5-fluoro-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol (CAS 861214-33-7) is a chemical compound with the molecular formula C16H10FN3O2 and a molecular weight of 295.27 g/mol. IUPAC name: 5-fluoro-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol. InChIKey: LAPHNLUPQPQSKF-UHFFFAOYSA-N.
| Molecular formula | C16H10FN3O2 |
|---|---|
| Molecular weight | 295.27 g/mol |
| IUPAC name | 5-fluoro-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol |
| InChIKey | LAPHNLUPQPQSKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=C(NC4=C3C=C(C=C4)F)O)N=O |
Computed by PubChem (NCBI)