Products 861317-20-6

CAS 861317-20-6 is the registry number for 1-[(4-Methylphenyl)amino]cyclopentanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-methylanilino)cyclopentane-1-carboxylic acid (CAS 861317-20-6) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-(4-methylanilino)cyclopentane-1-carboxylic acid. InChIKey: VTYHRBPLKFUBFN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO2
Molecular weight219.28 g/mol
IUPAC name1-(4-methylanilino)cyclopentane-1-carboxylic acid
InChIKeyVTYHRBPLKFUBFN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC2(CCCC2)C(=O)O

Computed by PubChem (NCBI)