CAS 861354-57-6 is the registry number for 3-Chloro-2,7-naphthalenedisulfonic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
3-chloronaphthalene-2,7-disulfonic acid (CAS 861354-57-6) is a chemical compound with the molecular formula C10H7ClO6S2 and a molecular weight of 322.7 g/mol. IUPAC name: 3-chloronaphthalene-2,7-disulfonic acid. InChIKey: HAAYLBIQGOZXRN-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO6S2 |
|---|---|
| Molecular weight | 322.7 g/mol |
| IUPAC name | 3-chloronaphthalene-2,7-disulfonic acid |
| InChIKey | HAAYLBIQGOZXRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)Cl)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)