Products 861354-57-6

CAS 861354-57-6 is the registry number for 3-Chloro-2,7-naphthalenedisulfonic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-chloronaphthalene-2,7-disulfonic acid (CAS 861354-57-6) is a chemical compound with the molecular formula C10H7ClO6S2 and a molecular weight of 322.7 g/mol. IUPAC name: 3-chloronaphthalene-2,7-disulfonic acid. InChIKey: HAAYLBIQGOZXRN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7ClO6S2
Molecular weight322.7 g/mol
IUPAC name3-chloronaphthalene-2,7-disulfonic acid
InChIKeyHAAYLBIQGOZXRN-UHFFFAOYSA-N
SMILESC1=CC(=CC2=CC(=C(C=C21)Cl)S(=O)(=O)O)S(=O)(=O)O

Computed by PubChem (NCBI)