CAS 861363-57-7 is the registry number for (2,3-Dichloro-6-nitrophenyl)-hydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2,3-dichloro-6-nitrophenyl)hydrazine (CAS 861363-57-7) is a chemical compound with the molecular formula C6H5Cl2N3O2 and a molecular weight of 222.03 g/mol. IUPAC name: (2,3-dichloro-6-nitrophenyl)hydrazine. InChIKey: SCCYTTMQISVZNF-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2N3O2 |
|---|---|
| Molecular weight | 222.03 g/mol |
| IUPAC name | (2,3-dichloro-6-nitrophenyl)hydrazine |
| InChIKey | SCCYTTMQISVZNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])NN)Cl)Cl |
Computed by PubChem (NCBI)