CAS 861398-52-9 appears in our catalog under these names: (S)-2-((3-((3-Fluorobenzyl)oxy)benzyl)amino)propanamide, 98%, Safinamide Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[[3-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanamide (CAS 861398-52-9) is a chemical compound with the molecular formula C17H19FN2O2 and a molecular weight of 302.34 g/mol. IUPAC name: (2S)-2-[[3-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanamide. InChIKey: XZVNPHMSKCAJKA-LBPRGKRZSA-N.
| Molecular formula | C17H19FN2O2 |
|---|---|
| Molecular weight | 302.34 g/mol |
| IUPAC name | (2S)-2-[[3-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanamide |
| InChIKey | XZVNPHMSKCAJKA-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)N)NCC1=CC(=CC=C1)OCC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)