Products 861555-67-1

CAS 861555-67-1 is the registry number for Fluralaner Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(hydroxymethyl)-2-methylbenzoic acid (CAS 861555-67-1) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: 4-(hydroxymethyl)-2-methylbenzoic acid. InChIKey: GAXTYDGCLIEMIG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O3
Molecular weight166.17 g/mol
IUPAC name4-(hydroxymethyl)-2-methylbenzoic acid
InChIKeyGAXTYDGCLIEMIG-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)CO)C(=O)O

Computed by PubChem (NCBI)