CAS 861605-27-8 is the registry number for 4-Azidophenylarsonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-azidophenyl)arsonic acid (CAS 861605-27-8) is a chemical compound with the molecular formula C6H6AsN3O3 and a molecular weight of 243.05 g/mol. IUPAC name: (4-azidophenyl)arsonic acid. InChIKey: ABBAHMOUCAIMOQ-UHFFFAOYSA-N.
| Molecular formula | C6H6AsN3O3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | (4-azidophenyl)arsonic acid |
| InChIKey | ABBAHMOUCAIMOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+]=[N-])[As](=O)(O)O |
Computed by PubChem (NCBI)