CAS 861781-97-7 appears in our catalog under these names: Ethyl 2,4,6-tribromobenzoate, 95%, Ethyl 2,4,6-tribromobenzoate, 98%, Ethyl 2,4,6-tribromobenzoate, ≥95%, ≥95%, Ethyl 2,4,6-tribromobenzoate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 2,4,6-tribromobenzoate (CAS 861781-97-7) is a chemical compound with the molecular formula C9H7Br3O2 and a molecular weight of 386.86 g/mol. IUPAC name: ethyl 2,4,6-tribromobenzoate. InChIKey: WITGESXYPLANNP-UHFFFAOYSA-N.
| Molecular formula | C9H7Br3O2 |
|---|---|
| Molecular weight | 386.86 g/mol |
| IUPAC name | ethyl 2,4,6-tribromobenzoate |
| InChIKey | WITGESXYPLANNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1Br)Br)Br |
Computed by PubChem (NCBI)