CAS 861869-12-7 is the registry number for Isopropenyloxytris(trimethylsilyl)silane. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Trimethyl-[prop-1-en-2-yloxy-bis(trimethylsilyl)silyl]silane (CAS 861869-12-7) is a chemical compound with the molecular formula C12H32OSi4 and a molecular weight of 304.72 g/mol. IUPAC name: trimethyl-[prop-1-en-2-yloxy-bis(trimethylsilyl)silyl]silane. InChIKey: PAQMOJBNTFYAFL-UHFFFAOYSA-N.
| Molecular formula | C12H32OSi4 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | trimethyl-[prop-1-en-2-yloxy-bis(trimethylsilyl)silyl]silane |
| InChIKey | PAQMOJBNTFYAFL-UHFFFAOYSA-N |
| SMILES | CC(=C)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
Computed by PubChem (NCBI)