CAS 861890-12-2 appears in our catalog under these names: 6,6'-Dibromo-[1,1'-binaphthalene]-2,2'-diamine, 97%, 97%, 6,6'-Dibromo-[1,1'-binaphthalene]-2,2'-diamine, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(2-amino-6-bromonaphthalen-1-yl)-6-bromonaphthalen-2-amine (CAS 861890-12-2) is a chemical compound with the molecular formula C20H14Br2N2 and a molecular weight of 442.1 g/mol. IUPAC name: 1-(2-amino-6-bromonaphthalen-1-yl)-6-bromonaphthalen-2-amine. InChIKey: ZSBNVMOCQBZNDW-UHFFFAOYSA-N.
| Molecular formula | C20H14Br2N2 |
|---|---|
| Molecular weight | 442.1 g/mol |
| IUPAC name | 1-(2-amino-6-bromonaphthalen-1-yl)-6-bromonaphthalen-2-amine |
| InChIKey | ZSBNVMOCQBZNDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C3=C(C=CC4=C3C=CC(=C4)Br)N)N)C=C1Br |
Computed by PubChem (NCBI)