CAS 861928-21-4 is the registry number for 4-bromo-2-[(tert-butyldimethylsilyl)oxy]benzaldehyde, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-2-[tert-butyl(dimethyl)silyl]oxybenzaldehyde (CAS 861928-21-4) is a chemical compound with the molecular formula C13H19BrO2Si and a molecular weight of 315.28 g/mol. IUPAC name: 4-bromo-2-[tert-butyl(dimethyl)silyl]oxybenzaldehyde. InChIKey: PGJQGQLSEFRHPT-UHFFFAOYSA-N.
| Molecular formula | C13H19BrO2Si |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | 4-bromo-2-[tert-butyl(dimethyl)silyl]oxybenzaldehyde |
| InChIKey | PGJQGQLSEFRHPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=CC(=C1)Br)C=O |
Computed by PubChem (NCBI)