CAS 861954-02-1 is the registry number for 2-(2-Propynyloxy)tetrahydropyran-13C3. Offered by: TRC. Available pack sizes: 25mg.
2-prop-2-ynoxy(2,3,4-13C3)oxane (CAS 861954-02-1) is a chemical compound with the molecular formula C8H12O2 and a molecular weight of 143.16 g/mol. IUPAC name: 2-prop-2-ynoxy(2,3,4-13C3)oxane. InChIKey: HQAXHIGPGBPPFU-VCOCTNKGSA-N.
| Molecular formula | C8H12O2 |
|---|---|
| Molecular weight | 143.16 g/mol |
| IUPAC name | 2-prop-2-ynoxy(2,3,4-13C3)oxane |
| InChIKey | HQAXHIGPGBPPFU-VCOCTNKGSA-N |
| SMILES | C#CCO[13CH]1[13CH2][13CH2]CCO1 |
Computed by PubChem (NCBI)