CAS 861998-77-8 is the registry number for Solifenacin Related Compound 29. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S,4R)-4-hydroxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 861998-77-8) is a chemical compound with the molecular formula C23H26N2O3 and a molecular weight of 378.5 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S,4R)-4-hydroxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: LRNNBJBAUXSVMH-FKBYEOEOSA-N.
| Molecular formula | C23H26N2O3 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1S,4R)-4-hydroxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | LRNNBJBAUXSVMH-FKBYEOEOSA-N |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)N3C[C@@H](C4=CC=CC=C4[C@@H]3C5=CC=CC=C5)O |
Computed by PubChem (NCBI)