CAS 862-53-3 is the registry number for 3α,7α,12α,26-Tetrahydroxy-5β-cholestane. Offered by: MedChemExpress. Available pack sizes: Get quote.
5beta-cholestane-3alpha,7alpha,12alpha,26-tetrol is a 3alpha-hydroxy steroid, a 7alpha-hydroxy steroid, a 12alpha-hydroxy steroid and a 26-hydroxy steroid. It has a role as a mouse metabolite and a human metabolite. It derives from a hydride of a 5beta-cholestane.
Source: ChEBI
| Molecular formula | C27H48O4 |
|---|---|
| Molecular weight | 436.7 g/mol |
| IUPAC name | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| InChIKey | XJZGNVBLVFOSKJ-XZULNKEGSA-N |
| SMILES | C[C@H](CCCC(C)CO)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C |
Computed by PubChem (NCBI)