CAS 862081-38-7 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isobenzofuran-1(3H)-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one (CAS 862081-38-7) is a chemical compound with the molecular formula C14H17BO4 and a molecular weight of 260.10 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one. InChIKey: WYVNPLWFLYLLAQ-UHFFFAOYSA-N.
| Molecular formula | C14H17BO4 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one |
| InChIKey | WYVNPLWFLYLLAQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(COC3=O)C=C2 |
Computed by PubChem (NCBI)