CAS 862090-74-2 appears in our catalog under these names: Chymase-IN-1, >95% (HPLC), Chymase-IN-1/ 99.21% (existing batch purity), Chymase–IN–1, Chymase-IN-1. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 1mg, 5mg, 50mg, 100mg, 500mg.
[1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid (CAS 862090-74-2) is a chemical compound with the molecular formula C20H15ClNO4PS and a molecular weight of 431.8 g/mol. IUPAC name: [1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid. InChIKey: HUJXISJLAPAFBO-UHFFFAOYSA-N.
| Molecular formula | C20H15ClNO4PS |
|---|---|
| Molecular weight | 431.8 g/mol |
| IUPAC name | [1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
| InChIKey | HUJXISJLAPAFBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)C(C3=CSC4=C3C=C(C=C4)Cl)P(=O)(O)O |
Computed by PubChem (NCBI)