CAS 862107-96-8 is the registry number for tert-Butyl ((3R,4R)-4-(difluoromethyl)pyrrolidin-3-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3R,4R)-4-(difluoromethyl)pyrrolidin-3-yl]carbamate (CAS 862107-96-8) is a chemical compound with the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-(difluoromethyl)pyrrolidin-3-yl]carbamate. InChIKey: SPVLYYWTWMUWDD-RQJHMYQMSA-N.
| Molecular formula | C10H18F2N2O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-(difluoromethyl)pyrrolidin-3-yl]carbamate |
| InChIKey | SPVLYYWTWMUWDD-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@H]1C(F)F |
Computed by PubChem (NCBI)