CAS 862112-25-2 appears in our catalog under these names: 5-(Trifluoromethyl)-1h-1,2,3-triazole-4-carboxylic acid, 96%, 5-(Trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid, 98+%, 5-(Trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic Acid, 5-(Trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid, 98%, 98%, 5-(TRIFLUOROMETHYL)-1H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, AmBeed, TRC, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg, 0,5g, 50mg, 100mg, 2.5g.
5-(trifluoromethyl)-2H-triazole-4-carboxylic acid (CAS 862112-25-2) is a chemical compound with the molecular formula C4H2F3N3O2 and a molecular weight of 181.07 g/mol. IUPAC name: 5-(trifluoromethyl)-2H-triazole-4-carboxylic acid. InChIKey: KUDUCYMVMGREMJ-UHFFFAOYSA-N.
| Molecular formula | C4H2F3N3O2 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2H-triazole-4-carboxylic acid |
| InChIKey | KUDUCYMVMGREMJ-UHFFFAOYSA-N |
| SMILES | C1(=NNN=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)