Products 862250-23-5
CAS 862250-23-5 is the registry number for FCPT. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-(4-fluorophenyl)cyclopropyl]-4-pyridin-4-yl-1,3-thiazole (CAS 862250-23-5) is a chemical compound with the molecular formula C17H13FN2S and a molecular weight of 296.4 g/mol. IUPAC name: 2-[1-(4-fluorophenyl)cyclopropyl]-4-pyridin-4-yl-1,3-thiazole. InChIKey: PVPYZVCHGWNKFZ-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2S |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-[1-(4-fluorophenyl)cyclopropyl]-4-pyridin-4-yl-1,3-thiazole |
| InChIKey | PVPYZVCHGWNKFZ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)F)C3=NC(=CS3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)