CAS 862690-19-5 is the registry number for Levofloxacin Methyl Ester. Offered by: TRC, Mikromol, Biosynth. Available pack sizes: 500mg, 4x25mg, 25mg, 100mg, 50mg, 250mg.
Ofloxacin methyl ester is a quinolone and an organofluorine compound.
Source: ChEBI
| Molecular formula | C19H22FN3O4 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | methyl (2S)-7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
| InChIKey | HSVIINWFPKEOEQ-NSHDSACASA-N |
| SMILES | C[C@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)OC |
Computed by PubChem (NCBI)