Products 86271-56-9

CAS 86271-56-9 appears in our catalog under these names: Phenazopyridine Impurity 5, 2,6-Diamino-5-hydroxy-3-(phenylazo)pyridine. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 2mg.

Structural formula: {0} (CAS {1})

2,6-diamino-5-phenyldiazenylpyridin-3-ol (CAS 86271-56-9) is a chemical compound with the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. IUPAC name: 2,6-diamino-5-phenyldiazenylpyridin-3-ol. InChIKey: BVBZFKYOQZLANE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N5O
Molecular weight229.24 g/mol
IUPAC name2,6-diamino-5-phenyldiazenylpyridin-3-ol
InChIKeyBVBZFKYOQZLANE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=NC2=CC(=C(N=C2N)N)O

Computed by PubChem (NCBI)