CAS 862807-89-4 is the registry number for 2-bromo-4-(2,4-dibromophenoxy)-Phenol. Offered by: TRC. Available pack sizes: 25mg.
2-bromo-4-(2,4-dibromophenoxy)phenol (CAS 862807-89-4) is a chemical compound with the molecular formula C12H7Br3O2 and a molecular weight of 422.89 g/mol. IUPAC name: 2-bromo-4-(2,4-dibromophenoxy)phenol. InChIKey: GRIMQKMDNNAKOA-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3O2 |
|---|---|
| Molecular weight | 422.89 g/mol |
| IUPAC name | 2-bromo-4-(2,4-dibromophenoxy)phenol |
| InChIKey | GRIMQKMDNNAKOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2)Br)Br)Br)O |
Computed by PubChem (NCBI)