CAS 862875-16-9 appears in our catalog under these names: Sorafenib Impurity 9, Sorafenib Impurity 73. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide (CAS 862875-16-9) is a chemical compound with the molecular formula C21H17F3N4O4 and a molecular weight of 446.4 g/mol. IUPAC name: 4-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide. InChIKey: NUDOMXMCXPMNQE-UHFFFAOYSA-N.
| Molecular formula | C21H17F3N4O4 |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | 4-[4-[[4-hydroxy-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| InChIKey | NUDOMXMCXPMNQE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)O)C(F)(F)F |
Computed by PubChem (NCBI)