CAS 862974-22-9 appears in our catalog under these names: HIF–1/2α–IN–2, HIF-1/2α-IN-2, 99.55%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 100 mg, 50 mg, 10 mg, 25 mg.
5-(4-fluorophenyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine (CAS 862974-22-9) is a chemical compound with the molecular formula C16H11FN4O2S and a molecular weight of 342.3 g/mol. IUPAC name: 5-(4-fluorophenyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: TUNSTYGNRZSNSX-UHFFFAOYSA-N.
| Molecular formula | C16H11FN4O2S |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | TUNSTYGNRZSNSX-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC=C1)SC(=N2)NC3=NN=C(O3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)