CAS 863001-19-8 is the registry number for 6-Bromo-2-(1-piperidinyl)benzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
6-bromo-2-piperidin-1-yl-1,3-benzothiazole (CAS 863001-19-8) is a chemical compound with the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. IUPAC name: 6-bromo-2-piperidin-1-yl-1,3-benzothiazole. InChIKey: ODLOQJNOPFZXLU-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2S |
|---|---|
| Molecular weight | 297.22 g/mol |
| IUPAC name | 6-bromo-2-piperidin-1-yl-1,3-benzothiazole |
| InChIKey | ODLOQJNOPFZXLU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC3=C(S2)C=C(C=C3)Br |
Computed by PubChem (NCBI)