CAS 86308-26-1 appears in our catalog under these names: 1-Hexylboronic acid pinacol ester, 98% , 1-HEXYLBORONIC ACID PINACOL ESTER, 98%, 98%, Hexylboronic acid pinacol ester, 2-Hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Thermo Scientific (Alfa Aesar), Chemat, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 86308-26-1) is a chemical compound with the molecular formula C12H25BO2 and a molecular weight of 212.14 g/mol. IUPAC name: 2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LDPMCSWZEGKWLC-UHFFFAOYSA-N.
| Molecular formula | C12H25BO2 |
|---|---|
| Molecular weight | 212.14 g/mol |
| IUPAC name | 2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LDPMCSWZEGKWLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCCCC |
Computed by PubChem (NCBI)