Products 86315-69-7
CAS 86315-69-7 is the registry number for LY137150. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-methoxy-4-methylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride (CAS 86315-69-7) is a chemical compound with the molecular formula C14H14ClN3OS and a molecular weight of 307.8 g/mol. IUPAC name: 2-(2-methoxy-4-methylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride. InChIKey: LMAGMIYNWNPGLS-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3OS |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 2-(2-methoxy-4-methylsulfanylphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride |
| InChIKey | LMAGMIYNWNPGLS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)SC)C2=NC3=C(N2)C=NC=C3.Cl |
Computed by PubChem (NCBI)