Products 86329-06-8
CAS 86329-06-8 is the registry number for CP59430. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(4-azidophenyl)methanone (CAS 86329-06-8) is a chemical compound with the molecular formula C21H22N8O3 and a molecular weight of 434.5 g/mol. IUPAC name: [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(4-azidophenyl)methanone. InChIKey: XHCZPSMUDVXSPQ-UHFFFAOYSA-N.
| Molecular formula | C21H22N8O3 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(4-azidophenyl)methanone |
| InChIKey | XHCZPSMUDVXSPQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4=CC=C(C=C4)N=[N+]=[N-])N)OC |
Computed by PubChem (NCBI)