Products 86347-62-8

CAS 86347-62-8 is the registry number for Medetomidine Impurity 25. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

5-[1-(2,3-dimethylphenyl)propyl]-1H-imidazole (CAS 86347-62-8) is a chemical compound with the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. IUPAC name: 5-[1-(2,3-dimethylphenyl)propyl]-1H-imidazole. InChIKey: SUATYMLMMXLYNH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2
Molecular weight214.31 g/mol
IUPAC name5-[1-(2,3-dimethylphenyl)propyl]-1H-imidazole
InChIKeySUATYMLMMXLYNH-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC(=C1C)C)C2=CN=CN2

Computed by PubChem (NCBI)