CAS 863514-54-9 appears in our catalog under these names: 4-(Dimethylamino)-4-(3-fluorophenyl)cyclohexan-1-one, 95%, 4-(dimethylamino)-4-(3-fluorophenyl)cyclohexan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg.
4-(dimethylamino)-4-(3-fluorophenyl)cyclohexan-1-one (CAS 863514-54-9) is a chemical compound with the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. IUPAC name: 4-(dimethylamino)-4-(3-fluorophenyl)cyclohexan-1-one. InChIKey: KBSNWMBGOWOJDD-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 4-(dimethylamino)-4-(3-fluorophenyl)cyclohexan-1-one |
| InChIKey | KBSNWMBGOWOJDD-UHFFFAOYSA-N |
| SMILES | CN(C)C1(CCC(=O)CC1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)