CAS 86357-59-7 is the registry number for N,N-Bis(2-Chloroethyl)-4-methoxybenzenesulfonamide. Offered by: TRC, Biosynth. Available pack sizes: 1g, 5000mg, 1000mg.
N,N-bis(2-chloroethyl)-4-methoxybenzenesulfonamide (CAS 86357-59-7) is a chemical compound with the molecular formula C11H15Cl2NO3S and a molecular weight of 312.2 g/mol. IUPAC name: N,N-bis(2-chloroethyl)-4-methoxybenzenesulfonamide. InChIKey: HUVWULNCGBXDRQ-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO3S |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | N,N-bis(2-chloroethyl)-4-methoxybenzenesulfonamide |
| InChIKey | HUVWULNCGBXDRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N(CCCl)CCCl |
Computed by PubChem (NCBI)