CAS 863589-44-0 is the registry number for 2,4-dimethoxy-N-(3-{[1,3]thiazolo[5,4-b]pyridin-2-yl}phenyl)benzamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
2,4-dimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide (CAS 863589-44-0) is a chemical compound with the molecular formula C21H17N3O3S and a molecular weight of 391.4 g/mol. IUPAC name: 2,4-dimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide. InChIKey: OOLNKALQNLNRAA-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O3S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 2,4-dimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
| InChIKey | OOLNKALQNLNRAA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)NC2=CC=CC(=C2)C3=NC4=C(S3)N=CC=C4)OC |
Computed by PubChem (NCBI)