CAS 863704-91-0 appears in our catalog under these names: PGN-9856, 98%, PGN–9856, 2-(3-(((3′,4-Difluoro(1,1′-biphenyl)-3-yl)carbonyl)amino)phenoxy)acetic acid, PGN-9856 98%, PGN-9856, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg, 5 mg.
2-[3-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenoxy]acetic acid (CAS 863704-91-0) is a chemical compound with the molecular formula C21H15F2NO4 and a molecular weight of 383.3 g/mol. IUPAC name: 2-[3-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenoxy]acetic acid. InChIKey: HZJWJNHYKNSGAT-UHFFFAOYSA-N.
| Molecular formula | C21H15F2NO4 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 2-[3-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenoxy]acetic acid |
| InChIKey | HZJWJNHYKNSGAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=C(C=C2)F)C(=O)NC3=CC(=CC=C3)OCC(=O)O |
Computed by PubChem (NCBI)