CAS 86383-32-6 appears in our catalog under these names: 5-Hydroxy Propafenone HCl, 5-Hydroxy Propafenone Hydrochloride, >95% (HPLC), 5-Hydroxypropafenone Hydrochloride, 5-Hydroxy propafenone hydrochloride, 5-Hydroxy Propafenone (hydrochloride). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, Biosynth. Available pack sizes: on request, 10mg, 1mg, 25mg, 4x25mg, 2mg, 5mg, 5 mg.
1-[5-hydroxy-2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride (CAS 86383-32-6) is a chemical compound with the molecular formula C21H28ClNO4 and a molecular weight of 393.9 g/mol. IUPAC name: 1-[5-hydroxy-2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride. InChIKey: FAYLNKVZLXBDBE-UHFFFAOYSA-N.
| Molecular formula | C21H28ClNO4 |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 1-[5-hydroxy-2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride |
| InChIKey | FAYLNKVZLXBDBE-UHFFFAOYSA-N |
| SMILES | CCCNCC(COC1=C(C=C(C=C1)O)C(=O)CCC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)