CAS 86386-77-8 appears in our catalog under these names: Fluconazole Impurity G Mesylate(EP), Fluconazole EP Impurity G Mesylate, 1-(((2RS)-2-(2,4-Difluorophenyl)oxiran-2-yl)methyl)-1H-1,2,4-triazole Mesilate, 2-(((2,4-Difluorophenyl)-2-oxiranyl)methyl)-1H-1,2,4-triazole methanesulfonate, Efinaconazole analogue-1 97%. Offered by: Chemat Brand, Mikromol, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 4x25mg, 25mg, 100mg, 50g, 25g, 100g, 250g.
1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;methanesulfonic acid (CAS 86386-77-8) is a chemical compound with the molecular formula C12H13F2N3O4S and a molecular weight of 333.31 g/mol. IUPAC name: 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;methanesulfonic acid. InChIKey: NJBRNNOGZPVNNR-UHFFFAOYSA-N.
| Molecular formula | C12H13F2N3O4S |
|---|---|
| Molecular weight | 333.31 g/mol |
| IUPAC name | 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole;methanesulfonic acid |
| InChIKey | NJBRNNOGZPVNNR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1C(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)