CAS 863868-35-3 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isophthalonitrile, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile (CAS 863868-35-3) is a chemical compound with the molecular formula C14H15BN2O2 and a molecular weight of 254.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile. InChIKey: KJXDOCVYTWZFRJ-UHFFFAOYSA-N.
| Molecular formula | C14H15BN2O2 |
|---|---|
| Molecular weight | 254.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile |
| InChIKey | KJXDOCVYTWZFRJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)