CAS 863870-41-1 is the registry number for 2-(2-2-Dibromovinyl)-4-fluorophenylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
2-(2,2-dibromoethenyl)-4-fluoroaniline (CAS 863870-41-1) is a chemical compound with the molecular formula C8H6Br2FN and a molecular weight of 294.95 g/mol. IUPAC name: 2-(2,2-dibromoethenyl)-4-fluoroaniline. InChIKey: VGDKYRIWBOTLBQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2FN |
|---|---|
| Molecular weight | 294.95 g/mol |
| IUPAC name | 2-(2,2-dibromoethenyl)-4-fluoroaniline |
| InChIKey | VGDKYRIWBOTLBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C=C(Br)Br)N |
Computed by PubChem (NCBI)