Products 863870-79-5
CAS 863870-79-5 is the registry number for 3-Bromo-2-iodophenyl diethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
(3-bromo-2-iodophenyl) N,N-diethylcarbamate (CAS 863870-79-5) is a chemical compound with the molecular formula C11H13BrINO2 and a molecular weight of 398.03 g/mol. IUPAC name: (3-bromo-2-iodophenyl) N,N-diethylcarbamate. InChIKey: AFPVOMGMCMFENO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrINO2 |
|---|---|
| Molecular weight | 398.03 g/mol |
| IUPAC name | (3-bromo-2-iodophenyl) N,N-diethylcarbamate |
| InChIKey | AFPVOMGMCMFENO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)Br)I |
Computed by PubChem (NCBI)