CAS 863870-80-8 is the registry number for 2,3-Dibromophenyl diethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
(2,3-dibromophenyl) N,N-diethylcarbamate (CAS 863870-80-8) is a chemical compound with the molecular formula C11H13Br2NO2 and a molecular weight of 351.03 g/mol. IUPAC name: (2,3-dibromophenyl) N,N-diethylcarbamate. InChIKey: FWYVHAXBUURRBW-UHFFFAOYSA-N.
| Molecular formula | C11H13Br2NO2 |
|---|---|
| Molecular weight | 351.03 g/mol |
| IUPAC name | (2,3-dibromophenyl) N,N-diethylcarbamate |
| InChIKey | FWYVHAXBUURRBW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)Br)Br |
Computed by PubChem (NCBI)