Products 863870-82-0

CAS 863870-82-0 is the registry number for 2,3-DiiodophenylN,N-diethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(2,3-diiodophenyl) N,N-diethylcarbamate (CAS 863870-82-0) is a chemical compound with the molecular formula C11H13I2NO2 and a molecular weight of 445.03 g/mol. IUPAC name: (2,3-diiodophenyl) N,N-diethylcarbamate. InChIKey: XZEIENGMIBARLF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13I2NO2
Molecular weight445.03 g/mol
IUPAC name(2,3-diiodophenyl) N,N-diethylcarbamate
InChIKeyXZEIENGMIBARLF-UHFFFAOYSA-N
SMILESCCN(CC)C(=O)OC1=C(C(=CC=C1)I)I

Computed by PubChem (NCBI)