Products 86392-41-8
CAS 86392-41-8 is the registry number for 5-Bromo-1-(1,1-dimethylethyl)-2-methoxy-3-methylbenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-tert-butyl-2-methoxy-3-methylbenzene (CAS 86392-41-8) is a chemical compound with the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. IUPAC name: 5-bromo-1-tert-butyl-2-methoxy-3-methylbenzene. InChIKey: VZKQKEKTPRGHOM-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 5-bromo-1-tert-butyl-2-methoxy-3-methylbenzene |
| InChIKey | VZKQKEKTPRGHOM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C(C)(C)C)Br |
Computed by PubChem (NCBI)