Products 863971-49-7
CAS 863971-49-7 is the registry number for Fmoc-MeVal-OSu. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoate (CAS 863971-49-7) is a chemical compound with the molecular formula C25H26N2O6 and a molecular weight of 450.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoate. InChIKey: CXZXQZADBBBLDB-QHCPKHFHSA-N.
| Molecular formula | C25H26N2O6 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoate |
| InChIKey | CXZXQZADBBBLDB-QHCPKHFHSA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)N(C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)